C13H18ClNO3S — CID 118463246
4-(4-tert-butyl-3-chlorophenyl)-1,3,4-oxathiazinane 3,3-dioxide (PubChem CID 118463246) has the molecular formula C13H18ClNO3S and a molecular weight of 303.81 g/mol. Its IUPAC name is 4-(4-tert-butyl-3-chlorophenyl)-1,3,4-oxathiazinane 3,3-dioxide.
| Compound Name | 4-(4-tert-butyl-3-chlorophenyl)-1,3,4-oxathiazinane 3,3-dioxide |
|---|---|
| PubChem CID | 118463246 |
| Molecular Formula | C13H18ClNO3S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 4-(4-tert-butyl-3-chlorophenyl)-1,3,4-oxathiazinane 3,3-dioxide |
| SMILES | CC(C)(C)c1ccc(N2CCOCS2(=O)=O)cc1Cl |
| InChI | InChI=1S/C13H18ClNO3S/c1-13(2,3)11-5-4-10(8-12(11)14)15-6-7-18-9-19(15,16)17/h4-5,8H,6-7,9H2,1-3H3 |
| InChIKey | NMJQCQVFXSPMAE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |