C14H16ClNO2S — CID 137390929
1-(4-tert-butyl-3-chlorophenyl)-3-sulfanylpyrrolidine-2,5-dione (PubChem CID 137390929) has the molecular formula C14H16ClNO2S and a molecular weight of 297.81 g/mol. Its IUPAC name is 1-(4-tert-butyl-3-chlorophenyl)-3-sulfanylpyrrolidine-2,5-dione.
| Compound Name | 1-(4-tert-butyl-3-chlorophenyl)-3-sulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 137390929 |
| Molecular Formula | C14H16ClNO2S |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 1-(4-tert-butyl-3-chlorophenyl)-3-sulfanylpyrrolidine-2,5-dione |
| SMILES | CC(C)(C)c1ccc(N2C(=O)CC(S)C2=O)cc1Cl |
| InChI | InChI=1S/C14H16ClNO2S/c1-14(2,3)9-5-4-8(6-10(9)15)16-12(17)7-11(19)13(16)18/h4-6,11,19H,7H2,1-3H3 |
| InChIKey | OIQVHWZZOVQZFJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|