C13H14N2O3S — CID 170751707
3-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)-N-ethylbenzamide (PubChem CID 170751707) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is 3-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)-N-ethylbenzamide.
| Compound Name | 3-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)-N-ethylbenzamide |
|---|---|
| PubChem CID | 170751707 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cccc(N2C(=O)CC(S)C2=O)c1 |
| InChI | InChI=1S/C13H14N2O3S/c1-2-14-12(17)8-4-3-5-9(6-8)15-11(16)7-10(19)13(15)18/h3-6,10,19H,2,7H2,1H3,(H,14,17) |
| InChIKey | QYJHNLBUEUTYDK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|