C13H10N4O3S — CID 11846376
5-(4-methoxyphenyl)-4-(2H-tetrazol-5-yl)thiophene-2-carboxylic acid (PubChem CID 11846376) has the molecular formula C13H10N4O3S and a molecular weight of 302.32 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-4-(2H-tetrazol-5-yl)thiophene-2-carboxylic acid.
| Compound Name | 5-(4-methoxyphenyl)-4-(2H-tetrazol-5-yl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 11846376 |
| Molecular Formula | C13H10N4O3S |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 5-(4-methoxyphenyl)-4-(2H-tetrazol-5-yl)thiophene-2-carboxylic acid |
| SMILES | COc1ccc(-c2sc(C(=O)O)cc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C13H10N4O3S/c1-20-8-4-2-7(3-5-8)11-9(12-14-16-17-15-12)6-10(21-11)13(18)19/h2-6H,1H3,(H,18,19)(H,14,15,16,17) |
| InChIKey | BUYIWVOOBPDNRY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |