C11H7N5O2S — CID 68713025
5-pyridin-2-yl-4-(2H-tetrazol-5-yl)thiophene-2-carboxylic acid (PubChem CID 68713025) has the molecular formula C11H7N5O2S and a molecular weight of 273.28 g/mol. Its IUPAC name is 5-pyridin-2-yl-4-(2H-tetrazol-5-yl)thiophene-2-carboxylic acid.
| Compound Name | 5-pyridin-2-yl-4-(2H-tetrazol-5-yl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 68713025 |
| Molecular Formula | C11H7N5O2S |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 5-pyridin-2-yl-4-(2H-tetrazol-5-yl)thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2nn[nH]n2)c(-c2ccccn2)s1 |
| InChI | InChI=1S/C11H7N5O2S/c17-11(18)8-5-6(10-13-15-16-14-10)9(19-8)7-3-1-2-4-12-7/h1-5H,(H,17,18)(H,13,14,15,16) |
| InChIKey | YWKQWKWSLYDBGR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |