C7H6N6O2S — CID 11846369
3-(2H-tetrazol-5-yl)thiophene-2,5-dicarboxamide (PubChem CID 11846369) has the molecular formula C7H6N6O2S and a molecular weight of 238.23 g/mol. Its IUPAC name is 3-(2H-tetrazol-5-yl)thiophene-2,5-dicarboxamide.
| Compound Name | 3-(2H-tetrazol-5-yl)thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 11846369 |
| Molecular Formula | C7H6N6O2S |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 3-(2H-tetrazol-5-yl)thiophene-2,5-dicarboxamide |
| SMILES | NC(=O)c1cc(-c2nn[nH]n2)c(C(N)=O)s1 |
| InChI | InChI=1S/C7H6N6O2S/c8-5(14)3-1-2(4(16-3)6(9)15)7-10-12-13-11-7/h1H,(H2,8,14)(H2,9,15)(H,10,11,12,13) |
| InChIKey | YAQPBCYKRWYGKJ-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 140.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |