C11H19F3N2O — CID 118465258
(2R,4R)-1-(oxan-4-yl)-2-(trifluoromethyl)piperidin-4-amine (PubChem CID 118465258) has the molecular formula C11H19F3N2O and a molecular weight of 252.28 g/mol. Its IUPAC name is (2R,4R)-1-(oxan-4-yl)-2-(trifluoromethyl)piperidin-4-amine.
| Compound Name | (2R,4R)-1-(oxan-4-yl)-2-(trifluoromethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 118465258 |
| Molecular Formula | C11H19F3N2O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (2R,4R)-1-(oxan-4-yl)-2-(trifluoromethyl)piperidin-4-amine |
| SMILES | N[C@@H]1CCN(C2CCOCC2)[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C11H19F3N2O/c12-11(13,14)10-7-8(15)1-4-16(10)9-2-5-17-6-3-9/h8-10H,1-7,15H2/t8-,10-/m1/s1 |
| InChIKey | UMYFPVTVINTOGC-PSASIEDQSA-N |
| XLogP | 1.52 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |