About 4-(4,4-dimethylcyclohexyl)-3-(trifluoromethyl)morpholine;ethane
4-(4,4-dimethylcyclohexyl)-3-(trifluoromethyl)morpholine;ethane (PubChem CID 170587880) has the molecular formula C15H28F3NO
and a molecular weight of 295.39 g/mol. Its IUPAC name is 4-(4,4-dimethylcyclohexyl)-3-(trifluoromethyl)morpholine;ethane.
Molecular Properties
| Compound Name | 4-(4,4-dimethylcyclohexyl)-3-(trifluoromethyl)morpholine;ethane |
| PubChem CID | 170587880 |
| Molecular Formula | C15H28F3NO |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 4-(4,4-dimethylcyclohexyl)-3-(trifluoromethyl)morpholine;ethane |
| SMILES | CC.CC1(C)CCC(N2CCOCC2C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H22F3NO.C2H6/c1-12(2)5-3-10(4-6-12)17-7-8-18-9-11(17)13(14,15)16;1-2/h10-11H,3-9H2,1-2H3;1-2H3 |
| InChIKey | LZVFMYNXLDPHOJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4,4-dimethylcyclohexyl)-3-(trifluoromethyl)morpholine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4-dimethylcyclohexyl)-3-(trifluoromethyl)morpholine;ethane?
The IUPAC name of 4-(4,4-dimethylcyclohexyl)-3-(trifluoromethyl)morpholine;ethane (CID 170587880) is 4-(4,4-dimethylcyclohexyl)-3-(trifluoromethyl)morpholine;ethane.
What is the SMILES notation for 4-(4,4-dimethylcyclohexyl)-3-(trifluoromethyl)morpholine;ethane?
The canonical SMILES for 4-(4,4-dimethylcyclohexyl)-3-(trifluoromethyl)morpholine;ethane is CC.CC1(C)CCC(N2CCOCC2C(F)(F)F)CC1.
What is the InChIKey of 4-(4,4-dimethylcyclohexyl)-3-(trifluoromethyl)morpholine;ethane?
The InChIKey is LZVFMYNXLDPHOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22F3NO.C2H6/c1-12(2)5-3-10(4-6-12)17-7-8-18-9-11(17)13(14,15)16;1-2/h10-11H,3-9H2,1-2H3;1-2H3.
What are the key properties of 4-(4,4-dimethylcyclohexyl)-3-(trifluoromethyl)morpholine;ethane?
4-(4,4-dimethylcyclohexyl)-3-(trifluoromethyl)morpholine;ethane has a molecular weight of 295.39 g/mol, XLogP of 4.24, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-dimethylcyclohexyl)-3-(trifluoromethyl)morpholine;ethane is sourced from PubChem (CID 170587880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).