C13H22F2N2O3 — CID 146014008
tert-butyl 3-[(1-aminocyclopropyl)-difluoromethyl]morpholine-4-carboxylate (PubChem CID 146014008) has the molecular formula C13H22F2N2O3 and a molecular weight of 292.33 g/mol. Its IUPAC name is tert-butyl 3-[(1-aminocyclopropyl)-difluoromethyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-[(1-aminocyclopropyl)-difluoromethyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 146014008 |
| Molecular Formula | C13H22F2N2O3 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | tert-butyl 3-[(1-aminocyclopropyl)-difluoromethyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOCC1C(F)(F)C1(N)CC1 |
| InChI | InChI=1S/C13H22F2N2O3/c1-11(2,3)20-10(18)17-6-7-19-8-9(17)13(14,15)12(16)4-5-12/h9H,4-8,16H2,1-3H3 |
| InChIKey | XJBFQEJDZBTFRX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |