C15H23NO6 — CID 11846584
tert-butyl (4S)-4-(5-ethenyl-2-oxo-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 11846584) has the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. Its IUPAC name is tert-butyl (4S)-4-(5-ethenyl-2-oxo-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-(5-ethenyl-2-oxo-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11846584 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | tert-butyl (4S)-4-(5-ethenyl-2-oxo-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C=CC1OC(=O)OC1[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23NO6/c1-7-10-11(21-13(18)20-10)9-8-19-15(5,6)16(9)12(17)22-14(2,3)4/h7,9-11H,1,8H2,2-6H3/t9-,10?,11?/m0/s1 |
| InChIKey | GFLGQCQKKCPQLQ-WHXUTIOJSA-N |
| XLogP | 2.45 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|