About 2-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]morpholine;hydrochloride
2-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]morpholine;hydrochloride (PubChem CID 118468513) has the molecular formula C12H14Cl2N4O2
and a molecular weight of 317.18 g/mol. Its IUPAC name is 2-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]morpholine;hydrochloride.
Molecular Properties
| Compound Name | 2-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]morpholine;hydrochloride |
| PubChem CID | 118468513 |
| Molecular Formula | C12H14Cl2N4O2 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 2-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]morpholine;hydrochloride |
| SMILES | Cl.Clc1cc2nccnc2c(OCC2CNCCO2)n1 |
| InChI | InChI=1S/C12H13ClN4O2.ClH/c13-10-5-9-11(16-2-1-15-9)12(17-10)19-7-8-6-14-3-4-18-8;/h1-2,5,8,14H,3-4,6-7H2;1H |
| InChIKey | DNHUMNOLHPZGRY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]morpholine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]morpholine;hydrochloride?
The IUPAC name of 2-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]morpholine;hydrochloride (CID 118468513) is 2-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]morpholine;hydrochloride.
What is the SMILES notation for 2-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]morpholine;hydrochloride?
The canonical SMILES for 2-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]morpholine;hydrochloride is Cl.Clc1cc2nccnc2c(OCC2CNCCO2)n1.
What is the InChIKey of 2-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]morpholine;hydrochloride?
The InChIKey is DNHUMNOLHPZGRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN4O2.ClH/c13-10-5-9-11(16-2-1-15-9)12(17-10)19-7-8-6-14-3-4-18-8;/h1-2,5,8,14H,3-4,6-7H2;1H.
What are the key properties of 2-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]morpholine;hydrochloride?
2-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]morpholine;hydrochloride has a molecular weight of 317.18 g/mol, XLogP of 1.47, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]morpholine;hydrochloride is sourced from PubChem (CID 118468513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).