C12H13ClN4O2 — CID 90202819
2-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]morpholine (PubChem CID 90202819) has the molecular formula C12H13ClN4O2 and a molecular weight of 280.71 g/mol. Its IUPAC name is 2-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]morpholine.
| Compound Name | 2-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]morpholine |
|---|---|
| PubChem CID | 90202819 |
| Molecular Formula | C12H13ClN4O2 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 2-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]morpholine |
| SMILES | Clc1cc2nccnc2c(OCC2CNCCO2)n1 |
| InChI | InChI=1S/C12H13ClN4O2/c13-10-5-9-11(16-2-1-15-9)12(17-10)19-7-8-6-14-3-4-18-8/h1-2,5,8,14H,3-4,6-7H2 |
| InChIKey | ROPLFVGPCJQKEZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|