C12H11ClN4O2 — CID 90202720
4-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]pyrrolidin-2-one (PubChem CID 90202720) has the molecular formula C12H11ClN4O2 and a molecular weight of 278.70 g/mol. Its IUPAC name is 4-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]pyrrolidin-2-one.
| Compound Name | 4-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 90202720 |
| Molecular Formula | C12H11ClN4O2 |
| Molecular Weight | 278.70 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 4-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]pyrrolidin-2-one |
| SMILES | O=C1CC(COc2nc(Cl)cc3nccnc23)CN1 |
| InChI | InChI=1S/C12H11ClN4O2/c13-9-4-8-11(15-2-1-14-8)12(17-9)19-6-7-3-10(18)16-5-7/h1-2,4,7H,3,5-6H2,(H,16,18) |
| InChIKey | YQLOOSZWYKJBDY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.70 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|