C12H13Cl2N3O2 — CID 167810090
2,6-dichloro-N-[2-(5-oxopyrrolidin-3-yl)ethyl]pyridine-4-carboxamide (PubChem CID 167810090) has the molecular formula C12H13Cl2N3O2 and a molecular weight of 302.16 g/mol. Its IUPAC name is 2,6-dichloro-N-[2-(5-oxopyrrolidin-3-yl)ethyl]pyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-[2-(5-oxopyrrolidin-3-yl)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 167810090 |
| Molecular Formula | C12H13Cl2N3O2 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 2,6-dichloro-N-[2-(5-oxopyrrolidin-3-yl)ethyl]pyridine-4-carboxamide |
| SMILES | O=C1CC(CCNC(=O)c2cc(Cl)nc(Cl)c2)CN1 |
| InChI | InChI=1S/C12H13Cl2N3O2/c13-9-4-8(5-10(14)17-9)12(19)15-2-1-7-3-11(18)16-6-7/h4-5,7H,1-3,6H2,(H,15,19)(H,16,18) |
| InChIKey | FDANOKIODIBSFR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|