C17H19NO3 — CID 118470407
(1S,9R,10S,14S)-18-methylidene-13-oxa-17-azapentacyclo[7.5.3.112,14.01,10.02,7]octadeca-2(7),3,5-triene-4,10-diol (PubChem CID 118470407) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is (1S,9R,10S,14S)-18-methylidene-13-oxa-17-azapentacyclo[7.5.3.112,14.01,10.02,7]octadeca-2(7),3,5-triene-4,10-diol.
| Compound Name | (1S,9R,10S,14S)-18-methylidene-13-oxa-17-azapentacyclo[7.5.3.112,14.01,10.02,7]octadeca-2(7),3,5-triene-4,10-diol |
|---|---|
| PubChem CID | 118470407 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | (1S,9R,10S,14S)-18-methylidene-13-oxa-17-azapentacyclo[7.5.3.112,14.01,10.02,7]octadeca-2(7),3,5-triene-4,10-diol |
| SMILES | C=C1C2C[C@@]3(O)[C@H]4Cc5ccc(O)cc5[C@@]3(CCN4)[C@H]1O2 |
| InChI | InChI=1S/C17H19NO3/c1-9-13-8-17(20)14-6-10-2-3-11(19)7-12(10)16(17,4-5-18-14)15(9)21-13/h2-3,7,13-15,18-20H,1,4-6,8H2/t13?,14-,15+,16+,17-/m1/s1 |
| InChIKey | UGECPMWSMMTFAL-IEYVUDCPSA-N |
| XLogP | 1.01 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|