C25H20F2N2O4 — CID 118473087
[3-[3-[4-[(2,6-difluorobenzoyl)amino]phenyl]-4-methylphenyl]-5-methyl-4H-1,2-oxazol-5-yl] formate (PubChem CID 118473087) has the molecular formula C25H20F2N2O4 and a molecular weight of 450.44 g/mol. Its IUPAC name is [3-[3-[4-[(2,6-difluorobenzoyl)amino]phenyl]-4-methylphenyl]-5-methyl-4H-1,2-oxazol-5-yl] formate.
| Compound Name | [3-[3-[4-[(2,6-difluorobenzoyl)amino]phenyl]-4-methylphenyl]-5-methyl-4H-1,2-oxazol-5-yl] formate |
|---|---|
| PubChem CID | 118473087 |
| Molecular Formula | C25H20F2N2O4 |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | [3-[3-[4-[(2,6-difluorobenzoyl)amino]phenyl]-4-methylphenyl]-5-methyl-4H-1,2-oxazol-5-yl] formate |
| SMILES | Cc1ccc(C2=NOC(C)(OC=O)C2)cc1-c1ccc(NC(=O)c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C25H20F2N2O4/c1-15-6-7-17(22-13-25(2,32-14-30)33-29-22)12-19(15)16-8-10-18(11-9-16)28-24(31)23-20(26)4-3-5-21(23)27/h3-12,14H,13H2,1-2H3,(H,28,31) |
| InChIKey | CZVTUMSSSXTNQX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|