C17H23N3O — CID 118473671
1-(2,3-diethyl-2-phenyloxan-3-yl)-1,2,4-triazole (PubChem CID 118473671) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-(2,3-diethyl-2-phenyloxan-3-yl)-1,2,4-triazole.
| Compound Name | 1-(2,3-diethyl-2-phenyloxan-3-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 118473671 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 1-(2,3-diethyl-2-phenyloxan-3-yl)-1,2,4-triazole |
| SMILES | CCC1(c2ccccc2)OCCCC1(CC)n1cncn1 |
| InChI | InChI=1S/C17H23N3O/c1-3-16(20-14-18-13-19-20)11-8-12-21-17(16,4-2)15-9-6-5-7-10-15/h5-7,9-10,13-14H,3-4,8,11-12H2,1-2H3 |
| InChIKey | XZXAGUJHSOVJPY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |