C21H22N2O2 — CID 54524191
1-[(4-ethyl-2,4-diphenyl-1,3-dioxolan-2-yl)methyl]imidazole (PubChem CID 54524191) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 1-[(4-ethyl-2,4-diphenyl-1,3-dioxolan-2-yl)methyl]imidazole.
| Compound Name | 1-[(4-ethyl-2,4-diphenyl-1,3-dioxolan-2-yl)methyl]imidazole |
|---|---|
| PubChem CID | 54524191 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 1-[(4-ethyl-2,4-diphenyl-1,3-dioxolan-2-yl)methyl]imidazole |
| SMILES | CCC1(c2ccccc2)COC(Cn2ccnc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C21H22N2O2/c1-2-20(18-9-5-3-6-10-18)16-24-21(25-20,15-23-14-13-22-17-23)19-11-7-4-8-12-19/h3-14,17H,2,15-16H2,1H3 |
| InChIKey | YRYNIRKBCBOBNM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |