C16H16IN3 — CID 118475363
4-[(4-iodocyclohexyl)amino]quinoline-6-carbonitrile (PubChem CID 118475363) has the molecular formula C16H16IN3 and a molecular weight of 377.23 g/mol. Its IUPAC name is 4-[(4-iodocyclohexyl)amino]quinoline-6-carbonitrile.
| Compound Name | 4-[(4-iodocyclohexyl)amino]quinoline-6-carbonitrile |
|---|---|
| PubChem CID | 118475363 |
| Molecular Formula | C16H16IN3 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 4-[(4-iodocyclohexyl)amino]quinoline-6-carbonitrile |
| SMILES | N#Cc1ccc2nccc(NC3CCC(I)CC3)c2c1 |
| InChI | InChI=1S/C16H16IN3/c17-12-2-4-13(5-3-12)20-16-7-8-19-15-6-1-11(10-18)9-14(15)16/h1,6-9,12-13H,2-5H2,(H,19,20) |
| InChIKey | NEKZRVDFFPTUAE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|