C17H23ClN6S2 — CID 173238028
azane;[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]thiourea;thiocyanic acid (PubChem CID 173238028) has the molecular formula C17H23ClN6S2 and a molecular weight of 411.00 g/mol. Its IUPAC name is azane;[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]thiourea;thiocyanic acid.
| Compound Name | azane;[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]thiourea;thiocyanic acid |
|---|---|
| PubChem CID | 173238028 |
| Molecular Formula | C17H23ClN6S2 |
| Molecular Weight | 411.00 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | azane;[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]thiourea;thiocyanic acid |
| SMILES | N.N#CS.NC(=S)NC1CCC(Nc2ccnc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C16H19ClN4S.CHNS.H3N/c17-10-1-6-13-14(7-8-19-15(13)9-10)20-11-2-4-12(5-3-11)21-16(18)22;2-1-3;/h1,6-9,11-12H,2-5H2,(H,19,20)(H3,18,21,22);3H;1H3 |
| InChIKey | OIIPXXAESITXHC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.00 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|