C25H26Cl3N7O — CID 118475673
N-[3-[[[5-chloro-2-[3,5-dichloro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide (PubChem CID 118475673) has the molecular formula C25H26Cl3N7O and a molecular weight of 546.89 g/mol. Its IUPAC name is N-[3-[[[5-chloro-2-[3,5-dichloro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[[5-chloro-2-[3,5-dichloro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118475673 |
| Molecular Formula | C25H26Cl3N7O |
| Molecular Weight | 546.89 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | N-[3-[[[5-chloro-2-[3,5-dichloro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(CNc2nc(Nc3cc(Cl)c(N4CCN(C)CC4)c(Cl)c3)ncc2Cl)c1 |
| InChI | InChI=1S/C25H26Cl3N7O/c1-3-22(36)31-17-6-4-5-16(11-17)14-29-24-21(28)15-30-25(33-24)32-18-12-19(26)23(20(27)13-18)35-9-7-34(2)8-10-35/h3-6,11-13,15H,1,7-10,14H2,2H3,(H,31,36)(H2,29,30,32,33) |
| InChIKey | MOTCNOIFTFHPQN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.89 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|