C19H28NOP — CID 118477693
[2-(2,5-dimethylpyrrol-1-yl)-6-methoxyphenyl]-di(propan-2-yl)phosphane (PubChem CID 118477693) has the molecular formula C19H28NOP and a molecular weight of 317.41 g/mol. Its IUPAC name is [2-(2,5-dimethylpyrrol-1-yl)-6-methoxyphenyl]-di(propan-2-yl)phosphane.
| Compound Name | [2-(2,5-dimethylpyrrol-1-yl)-6-methoxyphenyl]-di(propan-2-yl)phosphane |
|---|---|
| PubChem CID | 118477693 |
| Molecular Formula | C19H28NOP |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | [2-(2,5-dimethylpyrrol-1-yl)-6-methoxyphenyl]-di(propan-2-yl)phosphane |
| SMILES | COc1cccc(-n2c(C)ccc2C)c1P(C(C)C)C(C)C |
| InChI | InChI=1S/C19H28NOP/c1-13(2)22(14(3)4)19-17(9-8-10-18(19)21-7)20-15(5)11-12-16(20)6/h8-14H,1-7H3 |
| InChIKey | BWRBFWWZLJDSDQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|