C17H15ClN4 — CID 118482106
4-chloro-1-[(1,2-dimethylindol-5-yl)methyl]pyrazolo[4,5-c]pyridine (PubChem CID 118482106) has the molecular formula C17H15ClN4 and a molecular weight of 310.79 g/mol. Its IUPAC name is 4-chloro-1-[(1,2-dimethylindol-5-yl)methyl]pyrazolo[4,5-c]pyridine.
| Compound Name | 4-chloro-1-[(1,2-dimethylindol-5-yl)methyl]pyrazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 118482106 |
| Molecular Formula | C17H15ClN4 |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 4-chloro-1-[(1,2-dimethylindol-5-yl)methyl]pyrazolo[4,5-c]pyridine |
| SMILES | Cc1cc2cc(Cn3ncc4c(Cl)nccc43)ccc2n1C |
| InChI | InChI=1S/C17H15ClN4/c1-11-7-13-8-12(3-4-15(13)21(11)2)10-22-16-5-6-19-17(18)14(16)9-20-22/h3-9H,10H2,1-2H3 |
| InChIKey | ZDIFTERCYSDVQW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|