C17H17ClN4 — CID 144958003
2-chloro-N-[(1,2-dimethylindol-5-yl)methyl]-3-methanimidoylpyridin-4-amine (PubChem CID 144958003) has the molecular formula C17H17ClN4 and a molecular weight of 312.80 g/mol. Its IUPAC name is 2-chloro-N-[(1,2-dimethylindol-5-yl)methyl]-3-methanimidoylpyridin-4-amine.
| Compound Name | 2-chloro-N-[(1,2-dimethylindol-5-yl)methyl]-3-methanimidoylpyridin-4-amine |
|---|---|
| PubChem CID | 144958003 |
| Molecular Formula | C17H17ClN4 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-chloro-N-[(1,2-dimethylindol-5-yl)methyl]-3-methanimidoylpyridin-4-amine |
| SMILES | [H]/N=C/c1c(NCc2ccc3c(c2)cc(C)n3C)ccnc1Cl |
| InChI | InChI=1S/C17H17ClN4/c1-11-7-13-8-12(3-4-16(13)22(11)2)10-21-15-5-6-20-17(18)14(15)9-19/h3-9,19H,10H2,1-2H3,(H,20,21)/b19-9+ |
| InChIKey | GIOIFRHAKZJCRR-DJKKODMXSA-N |
| XLogP | 4.14 |
| TPSA | 53.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|