C31H59NO2 — CID 118483008
1-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoxy]-3-octoxypentan-2-amine (PubChem CID 118483008) has the molecular formula C31H59NO2 and a molecular weight of 477.82 g/mol. Its IUPAC name is 1-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoxy]-3-octoxypentan-2-amine.
| Compound Name | 1-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoxy]-3-octoxypentan-2-amine |
|---|---|
| PubChem CID | 118483008 |
| Molecular Formula | C31H59NO2 |
| Molecular Weight | 477.82 g/mol |
| Exact Mass | 477.45 |
| IUPAC Name | 1-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoxy]-3-octoxypentan-2-amine |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCCOCC(N)C(CC)OCCCCCCCC |
| InChI | InChI=1S/C31H59NO2/c1-4-7-9-11-13-14-15-16-17-18-19-20-21-22-23-25-27-33-29-30(32)31(6-3)34-28-26-24-12-10-8-5-2/h13-14,16-17,19-20,30-31H,4-12,15,18,21-29,32H2,1-3H3/b14-13-,17-16-,20-19- |
| InChIKey | HFIBANPXPTUSRG-BYBPBHJYSA-N |
| XLogP | 9.08 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.82 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|