C53H36N6 — CID 118483563
3-[4-[3,5-bis(3-phenyl-4-pyridin-3-ylphenyl)-1,2,4-triazol-4-yl]-2-phenylphenyl]pyridine (PubChem CID 118483563) has the molecular formula C53H36N6 and a molecular weight of 756.91 g/mol. Its IUPAC name is 3-[4-[3,5-bis(3-phenyl-4-pyridin-3-ylphenyl)-1,2,4-triazol-4-yl]-2-phenylphenyl]pyridine.
| Compound Name | 3-[4-[3,5-bis(3-phenyl-4-pyridin-3-ylphenyl)-1,2,4-triazol-4-yl]-2-phenylphenyl]pyridine |
|---|---|
| PubChem CID | 118483563 |
| Molecular Formula | C53H36N6 |
| Molecular Weight | 756.91 g/mol |
| Exact Mass | 756.30 |
| IUPAC Name | 3-[4-[3,5-bis(3-phenyl-4-pyridin-3-ylphenyl)-1,2,4-triazol-4-yl]-2-phenylphenyl]pyridine |
| SMILES | c1ccc(-c2cc(-c3nnc(-c4ccc(-c5cccnc5)c(-c5ccccc5)c4)n3-c3ccc(-c4cccnc4)c(-c4ccccc4)c3)ccc2-c2cccnc2)cc1 |
| InChI | InChI=1S/C53H36N6/c1-4-13-37(14-5-1)49-31-40(22-25-46(49)42-19-10-28-54-34-42)52-57-58-53(41-23-26-47(43-20-11-29-55-35-43)50(32-41)38-15-6-2-7-16-38)59(52)45-24-27-48(44-21-12-30-56-36-44)51(33-45)39-17-8-3-9-18-39/h1-36H |
| InChIKey | VHWSMHXPMFZDME-UHFFFAOYSA-N |
| XLogP | 12.79 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.91 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |