C8H12N2O3 — CID 118484483
[6-(cyanomethyl)oxan-3-yl]carbamic acid (PubChem CID 118484483) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is [6-(cyanomethyl)oxan-3-yl]carbamic acid.
| Compound Name | [6-(cyanomethyl)oxan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 118484483 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | [6-(cyanomethyl)oxan-3-yl]carbamic acid |
| SMILES | N#CCC1CCC(NC(=O)O)CO1 |
| InChI | InChI=1S/C8H12N2O3/c9-4-3-7-2-1-6(5-13-7)10-8(11)12/h6-7,10H,1-3,5H2,(H,11,12) |
| InChIKey | SQAXAKARQZOULR-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |