C8H14N2O5 — CID 175783825
[(3R,6S)-6-(carbamoyloxymethyl)oxan-3-yl]carbamic acid (PubChem CID 175783825) has the molecular formula C8H14N2O5 and a molecular weight of 218.21 g/mol. Its IUPAC name is [(3R,6S)-6-(carbamoyloxymethyl)oxan-3-yl]carbamic acid.
| Compound Name | [(3R,6S)-6-(carbamoyloxymethyl)oxan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 175783825 |
| Molecular Formula | C8H14N2O5 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | [(3R,6S)-6-(carbamoyloxymethyl)oxan-3-yl]carbamic acid |
| SMILES | NC(=O)OC[C@@H]1CC[C@@H](NC(=O)O)CO1 |
| InChI | InChI=1S/C8H14N2O5/c9-7(11)15-4-6-2-1-5(3-14-6)10-8(12)13/h5-6,10H,1-4H2,(H2,9,11)(H,12,13)/t5-,6+/m1/s1 |
| InChIKey | AOYGKRLUPPPUCZ-RITPCOANSA-N |
| XLogP | -0.10 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |