C30H42N4O6 — CID 118495795
[(3S)-3-benzyl-2-[(carboxyamino)-[(2S)-3-methyl-1-oxobutan-2-yl]amino]-5-[(3-methyl-1-oxobutan-2-yl)amino]-1-phenylpentan-2-yl]carbamic acid (PubChem CID 118495795) has the molecular formula C30H42N4O6 and a molecular weight of 554.69 g/mol. Its IUPAC name is [(3S)-3-benzyl-2-[(carboxyamino)-[(2S)-3-methyl-1-oxobutan-2-yl]amino]-5-[(3-methyl-1-oxobutan-2-yl)amino]-1-phenylpentan-2-yl]carbamic acid.
| Compound Name | [(3S)-3-benzyl-2-[(carboxyamino)-[(2S)-3-methyl-1-oxobutan-2-yl]amino]-5-[(3-methyl-1-oxobutan-2-yl)amino]-1-phenylpentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 118495795 |
| Molecular Formula | C30H42N4O6 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.31 |
| IUPAC Name | [(3S)-3-benzyl-2-[(carboxyamino)-[(2S)-3-methyl-1-oxobutan-2-yl]amino]-5-[(3-methyl-1-oxobutan-2-yl)amino]-1-phenylpentan-2-yl]carbamic acid |
| SMILES | CC(C)C(C=O)NCC[C@H](Cc1ccccc1)C(Cc1ccccc1)(NC(=O)O)N(NC(=O)O)[C@H](C=O)C(C)C |
| InChI | InChI=1S/C30H42N4O6/c1-21(2)26(19-35)31-16-15-25(17-23-11-7-5-8-12-23)30(32-28(37)38,18-24-13-9-6-10-14-24)34(33-29(39)40)27(20-36)22(3)4/h5-14,19-22,25-27,31-33H,15-18H2,1-4H3,(H,37,38)(H,39,40)/t25-,26?,27-,30?/m1/s1 |
| InChIKey | NMFXETAQUSWHTO-NZELDZCKSA-N |
| XLogP | 3.96 |
| TPSA | 148.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|