C39H44N4O6 — CID 87388739
[(3S)-3-benzyl-2-[[(2S)-1-(carboxyamino)-1-oxo-3-phenylpropan-2-yl]amino]-6-[(1-oxo-3-phenylpropan-2-yl)amino]-1-phenylhexan-2-yl]carbamic acid (PubChem CID 87388739) has the molecular formula C39H44N4O6 and a molecular weight of 664.80 g/mol. Its IUPAC name is [(3S)-3-benzyl-2-[[(2S)-1-(carboxyamino)-1-oxo-3-phenylpropan-2-yl]amino]-6-[(1-oxo-3-phenylpropan-2-yl)amino]-1-phenylhexan-2-yl]carbamic acid.
| Compound Name | [(3S)-3-benzyl-2-[[(2S)-1-(carboxyamino)-1-oxo-3-phenylpropan-2-yl]amino]-6-[(1-oxo-3-phenylpropan-2-yl)amino]-1-phenylhexan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87388739 |
| Molecular Formula | C39H44N4O6 |
| Molecular Weight | 664.80 g/mol |
| Exact Mass | 664.33 |
| IUPAC Name | [(3S)-3-benzyl-2-[[(2S)-1-(carboxyamino)-1-oxo-3-phenylpropan-2-yl]amino]-6-[(1-oxo-3-phenylpropan-2-yl)amino]-1-phenylhexan-2-yl]carbamic acid |
| SMILES | O=CC(Cc1ccccc1)NCCC[C@@H](Cc1ccccc1)C(Cc1ccccc1)(NC(=O)O)N[C@@H](Cc1ccccc1)C(=O)NC(=O)O |
| InChI | InChI=1S/C39H44N4O6/c44-28-34(25-30-16-7-2-8-17-30)40-23-13-22-33(24-29-14-5-1-6-15-29)39(43-38(48)49,27-32-20-11-4-12-21-32)42-35(36(45)41-37(46)47)26-31-18-9-3-10-19-31/h1-12,14-21,28,33-35,40,42-43H,13,22-27H2,(H,41,45)(H,46,47)(H,48,49)/t33-,34?,35-,39?/m0/s1 |
| InChIKey | QGOFHCIKTGDGLN-IVFXSKLHSA-N |
| XLogP | 5.23 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.80 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|