C10H12F2NO4P — CID 173298475
[difluoro-[(1-oxo-3-phenylpropan-2-yl)amino]methyl]phosphonic acid (PubChem CID 173298475) has the molecular formula C10H12F2NO4P and a molecular weight of 279.18 g/mol. Its IUPAC name is [difluoro-[(1-oxo-3-phenylpropan-2-yl)amino]methyl]phosphonic acid.
| Compound Name | [difluoro-[(1-oxo-3-phenylpropan-2-yl)amino]methyl]phosphonic acid |
|---|---|
| PubChem CID | 173298475 |
| Molecular Formula | C10H12F2NO4P |
| Molecular Weight | 279.18 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | [difluoro-[(1-oxo-3-phenylpropan-2-yl)amino]methyl]phosphonic acid |
| SMILES | O=CC(Cc1ccccc1)NC(F)(F)P(=O)(O)O |
| InChI | InChI=1S/C10H12F2NO4P/c11-10(12,18(15,16)17)13-9(7-14)6-8-4-2-1-3-5-8/h1-5,7,9,13H,6H2,(H2,15,16,17) |
| InChIKey | LXZYPAHTCNJZJU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.18 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|