C21H31N5O4 — CID 118506307
(2S)-2-[(1S)-2-[4-(2-morpholin-4-ylethoxymethyl)phenyl]-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid (PubChem CID 118506307) has the molecular formula C21H31N5O4 and a molecular weight of 417.51 g/mol. Its IUPAC name is (2S)-2-[(1S)-2-[4-(2-morpholin-4-ylethoxymethyl)phenyl]-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid.
| Compound Name | (2S)-2-[(1S)-2-[4-(2-morpholin-4-ylethoxymethyl)phenyl]-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid |
|---|---|
| PubChem CID | 118506307 |
| Molecular Formula | C21H31N5O4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | (2S)-2-[(1S)-2-[4-(2-morpholin-4-ylethoxymethyl)phenyl]-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid |
| SMILES | CCC[C@H](C(=O)O)[C@H](Cc1ccc(COCCN2CCOCC2)cc1)c1nn[nH]n1 |
| InChI | InChI=1S/C21H31N5O4/c1-2-3-18(21(27)28)19(20-22-24-25-23-20)14-16-4-6-17(7-5-16)15-30-13-10-26-8-11-29-12-9-26/h4-7,18-19H,2-3,8-15H2,1H3,(H,27,28)(H,22,23,24,25)/t18-,19-/m0/s1 |
| InChIKey | YBTAPSBWCMQVPY-OALUTQOASA-N |
| XLogP | 1.88 |
| TPSA | 113.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|