C25H34N6O3 — CID 144957698
(2S)-2-[(1S)-2-[4-[6-[4-(ethylamino)butan-2-yloxy]-2-pyridinyl]phenyl]-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid (PubChem CID 144957698) has the molecular formula C25H34N6O3 and a molecular weight of 466.59 g/mol. Its IUPAC name is (2S)-2-[(1S)-2-[4-[6-[4-(ethylamino)butan-2-yloxy]-2-pyridinyl]phenyl]-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid.
| Compound Name | (2S)-2-[(1S)-2-[4-[6-[4-(ethylamino)butan-2-yloxy]-2-pyridinyl]phenyl]-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid |
|---|---|
| PubChem CID | 144957698 |
| Molecular Formula | C25H34N6O3 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | (2S)-2-[(1S)-2-[4-[6-[4-(ethylamino)butan-2-yloxy]-2-pyridinyl]phenyl]-1-(2H-tetrazol-5-yl)ethyl]pentanoic acid |
| SMILES | CCCC(C(=O)O)[C@H](Cc1ccc(-c2cccc(OC(C)CCNCC)n2)cc1)c1nn[nH]n1 |
| InChI | InChI=1S/C25H34N6O3/c1-4-7-20(25(32)33)21(24-28-30-31-29-24)16-18-10-12-19(13-11-18)22-8-6-9-23(27-22)34-17(3)14-15-26-5-2/h6,8-13,17,20-21,26H,4-5,7,14-16H2,1-3H3,(H,32,33)(H,28,29,30,31)/t17?,20?,21-/m0/s1 |
| InChIKey | FVUYQXRPSNFKLT-JITJBCMDSA-N |
| XLogP | 3.86 |
| TPSA | 125.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|