C20H31N5O3 — CID 123845810
(5E)-2-ethyl-10-(morpholin-4-ylmethyl)-3-(2H-tetrazol-5-yl)dodeca-5,7,10-trienoic acid (PubChem CID 123845810) has the molecular formula C20H31N5O3 and a molecular weight of 389.50 g/mol. Its IUPAC name is (5E)-2-ethyl-10-(morpholin-4-ylmethyl)-3-(2H-tetrazol-5-yl)dodeca-5,7,10-trienoic acid.
| Compound Name | (5E)-2-ethyl-10-(morpholin-4-ylmethyl)-3-(2H-tetrazol-5-yl)dodeca-5,7,10-trienoic acid |
|---|---|
| PubChem CID | 123845810 |
| Molecular Formula | C20H31N5O3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | (5E)-2-ethyl-10-(morpholin-4-ylmethyl)-3-(2H-tetrazol-5-yl)dodeca-5,7,10-trienoic acid |
| SMILES | CC=C(CC=C/C=C/CC(c1nn[nH]n1)C(CC)C(=O)O)CN1CCOCC1 |
| InChI | InChI=1S/C20H31N5O3/c1-3-16(15-25-11-13-28-14-12-25)9-7-5-6-8-10-18(17(4-2)20(26)27)19-21-23-24-22-19/h3,5-8,17-18H,4,9-15H2,1-2H3,(H,26,27)(H,21,22,23,24)/b7-5?,8-6+,16-3? |
| InChIKey | GSBOQRUWPNRHJM-XOLAJDROSA-N |
| XLogP | 2.57 |
| TPSA | 104.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|