C8H14N4O2 — CID 123691063
2-[1-(2H-tetrazol-5-yl)ethyl]pentanoic acid (PubChem CID 123691063) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is 2-[1-(2H-tetrazol-5-yl)ethyl]pentanoic acid.
| Compound Name | 2-[1-(2H-tetrazol-5-yl)ethyl]pentanoic acid |
|---|---|
| PubChem CID | 123691063 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 2-[1-(2H-tetrazol-5-yl)ethyl]pentanoic acid |
| SMILES | CCCC(C(=O)O)C(C)c1nn[nH]n1 |
| InChI | InChI=1S/C8H14N4O2/c1-3-4-6(8(13)14)5(2)7-9-11-12-10-7/h5-6H,3-4H2,1-2H3,(H,13,14)(H,9,10,11,12) |
| InChIKey | GJVIVZZGAVDNOA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |