C36H54BrNO2 — CID 118510549
[10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-(4-bromophenyl)ethyl]carbamate (PubChem CID 118510549) has the molecular formula C36H54BrNO2 and a molecular weight of 612.74 g/mol. Its IUPAC name is [10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-(4-bromophenyl)ethyl]carbamate.
| Compound Name | [10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-(4-bromophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 118510549 |
| Molecular Formula | C36H54BrNO2 |
| Molecular Weight | 612.74 g/mol |
| Exact Mass | 611.33 |
| IUPAC Name | [10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-(4-bromophenyl)ethyl]carbamate |
| SMILES | CC(C)CCC[C@@H](C)C1CCC2C3CC=C4CC(OC(=O)NCCc5ccc(Br)cc5)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C36H54BrNO2/c1-24(2)7-6-8-25(3)31-15-16-32-30-14-11-27-23-29(17-20-35(27,4)33(30)18-21-36(31,32)5)40-34(39)38-22-19-26-9-12-28(37)13-10-26/h9-13,24-25,29-33H,6-8,14-23H2,1-5H3,(H,38,39)/t25-,29?,30?,31?,32?,33?,35?,36?/m1/s1 |
| InChIKey | YADMDGPCGMNWCG-KYYUXGAGSA-N |
| XLogP | 10.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.74 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|