C10H12N2O4 — CID 118518014
4,5-dimethyl-2-(2-oxopropanoylamino)furan-3-carboxamide (PubChem CID 118518014) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is 4,5-dimethyl-2-(2-oxopropanoylamino)furan-3-carboxamide.
| Compound Name | 4,5-dimethyl-2-(2-oxopropanoylamino)furan-3-carboxamide |
|---|---|
| PubChem CID | 118518014 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 4,5-dimethyl-2-(2-oxopropanoylamino)furan-3-carboxamide |
| SMILES | CC(=O)C(=O)Nc1oc(C)c(C)c1C(N)=O |
| InChI | InChI=1S/C10H12N2O4/c1-4-6(3)16-10(7(4)8(11)14)12-9(15)5(2)13/h1-3H3,(H2,11,14)(H,12,15) |
| InChIKey | VUAAPXGHYKGEQK-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|