C10H17N3 — CID 118519394
5-cyclohexyl-1,2-dihydropyridazin-3-amine (PubChem CID 118519394) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 5-cyclohexyl-1,2-dihydropyridazin-3-amine.
| Compound Name | 5-cyclohexyl-1,2-dihydropyridazin-3-amine |
|---|---|
| PubChem CID | 118519394 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 5-cyclohexyl-1,2-dihydropyridazin-3-amine |
| SMILES | NC1=CC(C2CCCCC2)=CNN1 |
| InChI | InChI=1S/C10H17N3/c11-10-6-9(7-12-13-10)8-4-2-1-3-5-8/h6-8,12-13H,1-5,11H2 |
| InChIKey | RCUWQSRFVGGTDA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |