C21H22F4N2O2 — CID 118521646
(3R)-1-[(4-cyclopropyloxyphenyl)methyl]-N-[3-fluoro-5-(trifluoromethyl)phenoxy]pyrrolidin-3-amine (PubChem CID 118521646) has the molecular formula C21H22F4N2O2 and a molecular weight of 410.41 g/mol. Its IUPAC name is (3R)-1-[(4-cyclopropyloxyphenyl)methyl]-N-[3-fluoro-5-(trifluoromethyl)phenoxy]pyrrolidin-3-amine.
| Compound Name | (3R)-1-[(4-cyclopropyloxyphenyl)methyl]-N-[3-fluoro-5-(trifluoromethyl)phenoxy]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 118521646 |
| Molecular Formula | C21H22F4N2O2 |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | (3R)-1-[(4-cyclopropyloxyphenyl)methyl]-N-[3-fluoro-5-(trifluoromethyl)phenoxy]pyrrolidin-3-amine |
| SMILES | Fc1cc(ON[C@@H]2CCN(Cc3ccc(OC4CC4)cc3)C2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H22F4N2O2/c22-16-9-15(21(23,24)25)10-20(11-16)29-26-17-7-8-27(13-17)12-14-1-3-18(4-2-14)28-19-5-6-19/h1-4,9-11,17,19,26H,5-8,12-13H2/t17-/m1/s1 |
| InChIKey | XWHSEDBUAMCFLJ-QGZVFWFLSA-N |
| XLogP | 4.54 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|