C21H19FN6O2 — CID 118525153
1-[(3R)-3-[[8-[3-(2-fluorophenoxy)prop-1-ynyl]-7H-purin-6-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 118525153) has the molecular formula C21H19FN6O2 and a molecular weight of 406.42 g/mol. Its IUPAC name is 1-[(3R)-3-[[8-[3-(2-fluorophenoxy)prop-1-ynyl]-7H-purin-6-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[[8-[3-(2-fluorophenoxy)prop-1-ynyl]-7H-purin-6-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118525153 |
| Molecular Formula | C21H19FN6O2 |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 1-[(3R)-3-[[8-[3-(2-fluorophenoxy)prop-1-ynyl]-7H-purin-6-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@@H](Nc2ncnc3nc(C#CCOc4ccccc4F)[nH]c23)C1 |
| InChI | InChI=1S/C21H19FN6O2/c1-2-18(29)28-10-9-14(12-28)25-20-19-21(24-13-23-20)27-17(26-19)8-5-11-30-16-7-4-3-6-15(16)22/h2-4,6-7,13-14H,1,9-12H2,(H2,23,24,25,26,27)/t14-/m1/s1 |
| InChIKey | XVBFXCHEWOHYLU-CQSZACIVSA-N |
| XLogP | 2.12 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|