C22H21FN6O2 — CID 123892432
1-[3-[[8-[2-[(2-fluorophenoxy)methyl]cyclopropen-1-yl]-7H-purin-6-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 123892432) has the molecular formula C22H21FN6O2 and a molecular weight of 420.45 g/mol. Its IUPAC name is 1-[3-[[8-[2-[(2-fluorophenoxy)methyl]cyclopropen-1-yl]-7H-purin-6-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[8-[2-[(2-fluorophenoxy)methyl]cyclopropen-1-yl]-7H-purin-6-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 123892432 |
| Molecular Formula | C22H21FN6O2 |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 1-[3-[[8-[2-[(2-fluorophenoxy)methyl]cyclopropen-1-yl]-7H-purin-6-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Nc2ncnc3nc(C4=C(COc5ccccc5F)C4)[nH]c23)C1 |
| InChI | InChI=1S/C22H21FN6O2/c1-2-18(30)29-8-7-14(10-29)26-21-19-22(25-12-24-21)28-20(27-19)15-9-13(15)11-31-17-6-4-3-5-16(17)23/h2-6,12,14H,1,7-11H2,(H2,24,25,26,27,28) |
| InChIKey | XHCTYUFRJOTOGA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|