C26H29N7O3 — CID 118525041
(E)-4-morpholin-4-yl-1-[3-[[8-(3-phenoxyprop-1-ynyl)-7H-purin-6-yl]amino]pyrrolidin-1-yl]but-2-en-1-one (PubChem CID 118525041) has the molecular formula C26H29N7O3 and a molecular weight of 487.56 g/mol. Its IUPAC name is (E)-4-morpholin-4-yl-1-[3-[[8-(3-phenoxyprop-1-ynyl)-7H-purin-6-yl]amino]pyrrolidin-1-yl]but-2-en-1-one.
| Compound Name | (E)-4-morpholin-4-yl-1-[3-[[8-(3-phenoxyprop-1-ynyl)-7H-purin-6-yl]amino]pyrrolidin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 118525041 |
| Molecular Formula | C26H29N7O3 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | (E)-4-morpholin-4-yl-1-[3-[[8-(3-phenoxyprop-1-ynyl)-7H-purin-6-yl]amino]pyrrolidin-1-yl]but-2-en-1-one |
| SMILES | O=C(/C=C/CN1CCOCC1)N1CCC(Nc2ncnc3nc(C#CCOc4ccccc4)[nH]c23)C1 |
| InChI | InChI=1S/C26H29N7O3/c34-23(9-4-11-32-13-16-35-17-14-32)33-12-10-20(18-33)29-25-24-26(28-19-27-25)31-22(30-24)8-5-15-36-21-6-2-1-3-7-21/h1-4,6-7,9,19-20H,10-18H2,(H2,27,28,29,30,31)/b9-4+ |
| InChIKey | QGGLKNWTOYWEDG-RUDMXATFSA-N |
| XLogP | 1.68 |
| TPSA | 108.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|