C21H18F2N6O2 — CID 118525162
1-[3-[[8-[3-(2,3-difluorophenoxy)prop-1-ynyl]-7H-purin-6-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 118525162) has the molecular formula C21H18F2N6O2 and a molecular weight of 424.41 g/mol. Its IUPAC name is 1-[3-[[8-[3-(2,3-difluorophenoxy)prop-1-ynyl]-7H-purin-6-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[8-[3-(2,3-difluorophenoxy)prop-1-ynyl]-7H-purin-6-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118525162 |
| Molecular Formula | C21H18F2N6O2 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 1-[3-[[8-[3-(2,3-difluorophenoxy)prop-1-ynyl]-7H-purin-6-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Nc2ncnc3nc(C#CCOc4cccc(F)c4F)[nH]c23)C1 |
| InChI | InChI=1S/C21H18F2N6O2/c1-2-17(30)29-9-8-13(11-29)26-20-19-21(25-12-24-20)28-16(27-19)7-4-10-31-15-6-3-5-14(22)18(15)23/h2-3,5-6,12-13H,1,8-11H2,(H2,24,25,26,27,28) |
| InChIKey | ZJPNCVQDILIQLQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|