C9H15NO — CID 118528711
2,3-dimethyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine (PubChem CID 118528711) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 2,3-dimethyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine.
| Compound Name | 2,3-dimethyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine |
|---|---|
| PubChem CID | 118528711 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 2,3-dimethyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine |
| SMILES | CC1OC2CCC=CN2C1C |
| InChI | InChI=1S/C9H15NO/c1-7-8(2)11-9-5-3-4-6-10(7)9/h4,6-9H,3,5H2,1-2H3 |
| InChIKey | VDEVQYAWDDJMMR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |