C7H13NS — CID 151294839
2-methyl-1-sulfanyl-2,3,4,5-tetrahydroazepine (PubChem CID 151294839) has the molecular formula C7H13NS and a molecular weight of 143.26 g/mol. Its IUPAC name is 2-methyl-1-sulfanyl-2,3,4,5-tetrahydroazepine.
| Compound Name | 2-methyl-1-sulfanyl-2,3,4,5-tetrahydroazepine |
|---|---|
| PubChem CID | 151294839 |
| Molecular Formula | C7H13NS |
| Molecular Weight | 143.26 g/mol |
| Exact Mass | 143.08 |
| IUPAC Name | 2-methyl-1-sulfanyl-2,3,4,5-tetrahydroazepine |
| SMILES | CC1CCCC=CN1S |
| InChI | InChI=1S/C7H13NS/c1-7-5-3-2-4-6-8(7)9/h4,6-7,9H,2-3,5H2,1H3 |
| InChIKey | OBEMUDGQALEUSI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|