C7H12FNO3S — CID 118531086
1-(1,1-dioxo-1,4-thiazinan-4-yl)-2-fluoropropan-1-one (PubChem CID 118531086) has the molecular formula C7H12FNO3S and a molecular weight of 209.24 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,4-thiazinan-4-yl)-2-fluoropropan-1-one.
| Compound Name | 1-(1,1-dioxo-1,4-thiazinan-4-yl)-2-fluoropropan-1-one |
|---|---|
| PubChem CID | 118531086 |
| Molecular Formula | C7H12FNO3S |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 1-(1,1-dioxo-1,4-thiazinan-4-yl)-2-fluoropropan-1-one |
| SMILES | CC(F)C(=O)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C7H12FNO3S/c1-6(8)7(10)9-2-4-13(11,12)5-3-9/h6H,2-5H2,1H3 |
| InChIKey | AJNDEHQPZKIMMZ-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |