C7H9F4NO3S — CID 103733485
1-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2,3,3-tetrafluoropropan-1-one (PubChem CID 103733485) has the molecular formula C7H9F4NO3S and a molecular weight of 263.21 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2,3,3-tetrafluoropropan-1-one.
| Compound Name | 1-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2,3,3-tetrafluoropropan-1-one |
|---|---|
| PubChem CID | 103733485 |
| Molecular Formula | C7H9F4NO3S |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 1-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2,3,3-tetrafluoropropan-1-one |
| SMILES | O=C(N1CCS(=O)(=O)CC1)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H9F4NO3S/c8-5(9)7(10,11)6(13)12-1-3-16(14,15)4-2-12/h5H,1-4H2 |
| InChIKey | QWPSSCBLWYJXRA-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|