C13H23F2N3 — CID 118533762
(3aS,6aR)-2-[(4,4-difluorocyclohexyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-amine (PubChem CID 118533762) has the molecular formula C13H23F2N3 and a molecular weight of 259.34 g/mol. Its IUPAC name is (3aS,6aR)-2-[(4,4-difluorocyclohexyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-amine.
| Compound Name | (3aS,6aR)-2-[(4,4-difluorocyclohexyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-amine |
|---|---|
| PubChem CID | 118533762 |
| Molecular Formula | C13H23F2N3 |
| Molecular Weight | 259.34 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (3aS,6aR)-2-[(4,4-difluorocyclohexyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-amine |
| SMILES | NN1C[C@@H]2CN(CC3CCC(F)(F)CC3)C[C@@H]2C1 |
| InChI | InChI=1S/C13H23F2N3/c14-13(15)3-1-10(2-4-13)5-17-6-11-8-18(16)9-12(11)7-17/h10-12H,1-9,16H2/t11-,12+ |
| InChIKey | WMKCRQQWEMIUSI-TXEJJXNPSA-N |
| XLogP | 1.55 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|