C13H21F2IN2 — CID 144963084
(3aS,6aR)-2-[(4,4-difluorocyclohexyl)methyl]-5-iodo-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 144963084) has the molecular formula C13H21F2IN2 and a molecular weight of 370.23 g/mol. Its IUPAC name is (3aS,6aR)-2-[(4,4-difluorocyclohexyl)methyl]-5-iodo-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | (3aS,6aR)-2-[(4,4-difluorocyclohexyl)methyl]-5-iodo-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 144963084 |
| Molecular Formula | C13H21F2IN2 |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | (3aS,6aR)-2-[(4,4-difluorocyclohexyl)methyl]-5-iodo-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | FC1(F)CCC(CN2C[C@H]3CN(I)C[C@H]3C2)CC1 |
| InChI | InChI=1S/C13H21F2IN2/c14-13(15)3-1-10(2-4-13)5-17-6-11-8-18(16)9-12(11)7-17/h10-12H,1-9H2/t11-,12+ |
| InChIKey | HJVFWHLVQJZIEW-TXEJJXNPSA-N |
| XLogP | 3.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|