C32H22Cl2NOP — CID 118536869
3,4-bis(3-chlorophenyl)-1,2-diphenyl-2,1λ5-benzazaphosphinine 1-oxide (PubChem CID 118536869) has the molecular formula C32H22Cl2NOP and a molecular weight of 538.41 g/mol. Its IUPAC name is 3,4-bis(3-chlorophenyl)-1,2-diphenyl-2,1λ5-benzazaphosphinine 1-oxide.
| Compound Name | 3,4-bis(3-chlorophenyl)-1,2-diphenyl-2,1λ5-benzazaphosphinine 1-oxide |
|---|---|
| PubChem CID | 118536869 |
| Molecular Formula | C32H22Cl2NOP |
| Molecular Weight | 538.41 g/mol |
| Exact Mass | 537.08 |
| IUPAC Name | 3,4-bis(3-chlorophenyl)-1,2-diphenyl-2,1λ5-benzazaphosphinine 1-oxide |
| SMILES | O=P1(c2ccccc2)c2ccccc2C(c2cccc(Cl)c2)=C(c2cccc(Cl)c2)N1c1ccccc1 |
| InChI | InChI=1S/C32H22Cl2NOP/c33-25-13-9-11-23(21-25)31-29-19-7-8-20-30(29)37(36,28-17-5-2-6-18-28)35(27-15-3-1-4-16-27)32(31)24-12-10-14-26(34)22-24/h1-22H |
| InChIKey | FURBQVWQYXWQAU-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.41 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|